C22H18ClN3O5 — CID 42985538
[2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 42985538) has the molecular formula C22H18ClN3O5 and a molecular weight of 439.86 g/mol. Its IUPAC name is [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 42985538 |
| Molecular Formula | C22H18ClN3O5 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1cccc(N2C(=O)CCC2=O)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O5/c23-16-5-2-6-17(13-16)25(11-3-10-24)21(29)14-31-22(30)15-4-1-7-18(12-15)26-19(27)8-9-20(26)28/h1-2,4-7,12-13H,3,8-9,11,14H2 |
| InChIKey | HULKKFRQZQZYLF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|