C18H14ClN3O2 — CID 2469813
N-(3-chlorophenyl)-N-(2-cyanoethyl)-2-(4-cyanophenoxy)acetamide (PubChem CID 2469813) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-(2-cyanoethyl)-2-(4-cyanophenoxy)acetamide.
| Compound Name | N-(3-chlorophenyl)-N-(2-cyanoethyl)-2-(4-cyanophenoxy)acetamide |
|---|---|
| PubChem CID | 2469813 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-(3-chlorophenyl)-N-(2-cyanoethyl)-2-(4-cyanophenoxy)acetamide |
| SMILES | N#CCCN(C(=O)COc1ccc(C#N)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H14ClN3O2/c19-15-3-1-4-16(11-15)22(10-2-9-20)18(23)13-24-17-7-5-14(12-21)6-8-17/h1,3-8,11H,2,10,13H2 |
| InChIKey | HFDRSERJSVFQNA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |