C16H13Cl2N3O3 — CID 43051020
[2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate (PubChem CID 43051020) has the molecular formula C16H13Cl2N3O3 and a molecular weight of 366.20 g/mol. Its IUPAC name is [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate.
| Compound Name | [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 43051020 |
| Molecular Formula | C16H13Cl2N3O3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate |
| SMILES | N#CCCN(C(=O)COC(=O)c1cc(Cl)c[nH]1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N3O3/c17-11-3-1-4-13(7-11)21(6-2-5-19)15(22)10-24-16(23)14-8-12(18)9-20-14/h1,3-4,7-9,20H,2,6,10H2 |
| InChIKey | VUNOLNBETWOWGH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |