C23H26ClN3O5S — CID 42985621
[2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate (PubChem CID 42985621) has the molecular formula C23H26ClN3O5S and a molecular weight of 492.00 g/mol. Its IUPAC name is [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate.
| Compound Name | [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 42985621 |
| Molecular Formula | C23H26ClN3O5S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)OCC(=O)N(CCC#N)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H26ClN3O5S/c1-4-26(5-2)33(30,31)20-11-10-17(3)21(15-20)23(29)32-16-22(28)27(13-7-12-25)19-9-6-8-18(24)14-19/h6,8-11,14-15H,4-5,7,13,16H2,1-3H3 |
| InChIKey | OAWBZGDXSCSQLU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |