C21H16BrNO4 — CID 92538837
(4-bromophenyl) 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate (PubChem CID 92538837) has the molecular formula C21H16BrNO4 and a molecular weight of 426.27 g/mol. Its IUPAC name is (4-bromophenyl) 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate.
| Compound Name | (4-bromophenyl) 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 92538837 |
| Molecular Formula | C21H16BrNO4 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | (4-bromophenyl) 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
| SMILES | O=C(Oc1ccc(Br)cc1)c1cccc(N2C(=O)[C@@H]3CC=CC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C21H16BrNO4/c22-14-8-10-16(11-9-14)27-21(26)13-4-3-5-15(12-13)23-19(24)17-6-1-2-7-18(17)20(23)25/h1-5,8-12,17-18H,6-7H2/t17-,18-/m1/s1 |
| InChIKey | DUULKVGZNXDICI-QZTJIDSGSA-N |
| XLogP | 4.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|