C25H19NO4 — CID 27903182
naphthalen-1-yl 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate (PubChem CID 27903182) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is naphthalen-1-yl 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate.
| Compound Name | naphthalen-1-yl 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 27903182 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | naphthalen-1-yl 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
| SMILES | O=C(Oc1cccc2ccccc12)c1cccc(N2C(=O)[C@H]3CC=CC[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C25H19NO4/c27-23-20-12-3-4-13-21(20)24(28)26(23)18-10-5-9-17(15-18)25(29)30-22-14-6-8-16-7-1-2-11-19(16)22/h1-11,14-15,20-21H,12-13H2/t20-,21-/m0/s1 |
| InChIKey | KZSMPEBIMWPTFJ-SFTDATJTSA-N |
| XLogP | 4.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|