C34H32N2O4 — CID 59005525
[2-(4-cyclopentylphenyl)-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-(diethylamino)benzoate (PubChem CID 59005525) has the molecular formula C34H32N2O4 and a molecular weight of 532.64 g/mol. Its IUPAC name is [2-(4-cyclopentylphenyl)-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-(diethylamino)benzoate.
| Compound Name | [2-(4-cyclopentylphenyl)-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 59005525 |
| Molecular Formula | C34H32N2O4 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | [2-(4-cyclopentylphenyl)-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)Oc2cc3c4c(cccc4c2)C(=O)N(c2ccc(C4CCCC4)cc2)C3=O)cc1 |
| InChI | InChI=1S/C34H32N2O4/c1-3-35(4-2)26-16-14-24(15-17-26)34(39)40-28-20-25-10-7-11-29-31(25)30(21-28)33(38)36(32(29)37)27-18-12-23(13-19-27)22-8-5-6-9-22/h7,10-22H,3-6,8-9H2,1-2H3 |
| InChIKey | SGMUQHMOOJVTAD-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|