C36H25N3O5 — CID 59005379
6-(4-cyclopentylphenyl)-13-(3-pyridin-2-yloxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 59005379) has the molecular formula C36H25N3O5 and a molecular weight of 579.61 g/mol. Its IUPAC name is 6-(4-cyclopentylphenyl)-13-(3-pyridin-2-yloxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(4-cyclopentylphenyl)-13-(3-pyridin-2-yloxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 59005379 |
| Molecular Formula | C36H25N3O5 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 6-(4-cyclopentylphenyl)-13-(3-pyridin-2-yloxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1ccc(C2CCCC2)cc1)C(=O)N(c1cccc(Oc2ccccn2)c1)C3=O |
| InChI | InChI=1S/C36H25N3O5/c40-33-26-15-17-28-32-29(36(43)39(35(28)42)24-8-5-9-25(20-24)44-30-10-3-4-19-37-30)18-16-27(31(26)32)34(41)38(33)23-13-11-22(12-14-23)21-6-1-2-7-21/h3-5,8-21H,1-2,6-7H2 |
| InChIKey | OBNIVBKUYUYJTN-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|