C26H21NO4 — CID 59005607
[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] (E)-3-cyclopentylprop-2-enoate (PubChem CID 59005607) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is [4-(1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] (E)-3-cyclopentylprop-2-enoate.
| Compound Name | [4-(1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] (E)-3-cyclopentylprop-2-enoate |
|---|---|
| PubChem CID | 59005607 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [4-(1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl] (E)-3-cyclopentylprop-2-enoate |
| SMILES | O=C(/C=C/C1CCCC1)Oc1ccc(N2C(=O)c3cccc4cccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C26H21NO4/c28-23(16-11-17-5-1-2-6-17)31-20-14-12-19(13-15-20)27-25(29)21-9-3-7-18-8-4-10-22(24(18)21)26(27)30/h3-4,7-17H,1-2,5-6H2/b16-11+ |
| InChIKey | UXQAWMUJTBAGAK-LFIBNONCSA-N |
| XLogP | 5.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|