C30H23NO4S — CID 59005488
[4-(1,3-dioxo-6-phenylsulfanylbenzo[de]isoquinolin-2-yl)phenyl] cyclopentanecarboxylate (PubChem CID 59005488) has the molecular formula C30H23NO4S and a molecular weight of 493.58 g/mol. Its IUPAC name is [4-(1,3-dioxo-6-phenylsulfanylbenzo[de]isoquinolin-2-yl)phenyl] cyclopentanecarboxylate.
| Compound Name | [4-(1,3-dioxo-6-phenylsulfanylbenzo[de]isoquinolin-2-yl)phenyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 59005488 |
| Molecular Formula | C30H23NO4S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [4-(1,3-dioxo-6-phenylsulfanylbenzo[de]isoquinolin-2-yl)phenyl] cyclopentanecarboxylate |
| SMILES | O=C(Oc1ccc(N2C(=O)c3cccc4c(Sc5ccccc5)ccc(c34)C2=O)cc1)C1CCCC1 |
| InChI | InChI=1S/C30H23NO4S/c32-28-24-12-6-11-23-26(36-22-9-2-1-3-10-22)18-17-25(27(23)24)29(33)31(28)20-13-15-21(16-14-20)35-30(34)19-7-4-5-8-19/h1-3,6,9-19H,4-5,7-8H2 |
| InChIKey | BXHMUAANCZGYFX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|