About [4-(diethylamino)phenyl] benzoate
[4-(diethylamino)phenyl] benzoate (PubChem CID 67071301) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is [4-(diethylamino)phenyl] benzoate.
Molecular Properties
| Compound Name | [4-(diethylamino)phenyl] benzoate |
| PubChem CID | 67071301 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [4-(diethylamino)phenyl] benzoate |
| SMILES | CCN(CC)c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO2/c1-3-18(4-2)15-10-12-16(13-11-15)20-17(19)14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3 |
| InChIKey | WZFOUELQWJUYIF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(diethylamino)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(diethylamino)phenyl] benzoate?
The IUPAC name of [4-(diethylamino)phenyl] benzoate (CID 67071301) is [4-(diethylamino)phenyl] benzoate.
What is the SMILES notation for [4-(diethylamino)phenyl] benzoate?
The canonical SMILES for [4-(diethylamino)phenyl] benzoate is CCN(CC)c1ccc(OC(=O)c2ccccc2)cc1.
What is the InChIKey of [4-(diethylamino)phenyl] benzoate?
The InChIKey is WZFOUELQWJUYIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-3-18(4-2)15-10-12-16(13-11-15)20-17(19)14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3.
What are the key properties of [4-(diethylamino)phenyl] benzoate?
[4-(diethylamino)phenyl] benzoate has a molecular weight of 269.34 g/mol, XLogP of 3.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(diethylamino)phenyl] benzoate is sourced from PubChem (CID 67071301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).