About [4-(propylamino)phenyl] benzoate
[4-(propylamino)phenyl] benzoate (PubChem CID 82532431) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is [4-(propylamino)phenyl] benzoate.
Molecular Properties
| Compound Name | [4-(propylamino)phenyl] benzoate |
| PubChem CID | 82532431 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | [4-(propylamino)phenyl] benzoate |
| SMILES | CCCNc1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-2-12-17-14-8-10-15(11-9-14)19-16(18)13-6-4-3-5-7-13/h3-11,17H,2,12H2,1H3 |
| InChIKey | GGKFIBAQRRUOOK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(propylamino)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(propylamino)phenyl] benzoate?
The IUPAC name of [4-(propylamino)phenyl] benzoate (CID 82532431) is [4-(propylamino)phenyl] benzoate.
What is the SMILES notation for [4-(propylamino)phenyl] benzoate?
The canonical SMILES for [4-(propylamino)phenyl] benzoate is CCCNc1ccc(OC(=O)c2ccccc2)cc1.
What is the InChIKey of [4-(propylamino)phenyl] benzoate?
The InChIKey is GGKFIBAQRRUOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-2-12-17-14-8-10-15(11-9-14)19-16(18)13-6-4-3-5-7-13/h3-11,17H,2,12H2,1H3.
What are the key properties of [4-(propylamino)phenyl] benzoate?
[4-(propylamino)phenyl] benzoate has a molecular weight of 255.32 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(propylamino)phenyl] benzoate is sourced from PubChem (CID 82532431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).