C26H29NO6 — CID 23038275
[4-butanoyloxy-2,3-dimethoxy-7-(propylamino)naphthalen-1-yl] benzoate (PubChem CID 23038275) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is [4-butanoyloxy-2,3-dimethoxy-7-(propylamino)naphthalen-1-yl] benzoate.
| Compound Name | [4-butanoyloxy-2,3-dimethoxy-7-(propylamino)naphthalen-1-yl] benzoate |
|---|---|
| PubChem CID | 23038275 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [4-butanoyloxy-2,3-dimethoxy-7-(propylamino)naphthalen-1-yl] benzoate |
| SMILES | CCCNc1ccc2c(OC(=O)CCC)c(OC)c(OC)c(OC(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C26H29NO6/c1-5-10-21(28)32-22-19-14-13-18(27-15-6-2)16-20(19)23(25(31-4)24(22)30-3)33-26(29)17-11-8-7-9-12-17/h7-9,11-14,16,27H,5-6,10,15H2,1-4H3 |
| InChIKey | HLVPKOLRWQFKLQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|