C17H19NO6 — CID 23038333
[4-acetyloxy-2,3-dimethoxy-6-(methylamino)naphthalen-1-yl] acetate (PubChem CID 23038333) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is [4-acetyloxy-2,3-dimethoxy-6-(methylamino)naphthalen-1-yl] acetate.
| Compound Name | [4-acetyloxy-2,3-dimethoxy-6-(methylamino)naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 23038333 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [4-acetyloxy-2,3-dimethoxy-6-(methylamino)naphthalen-1-yl] acetate |
| SMILES | CNc1ccc2c(OC(C)=O)c(OC)c(OC)c(OC(C)=O)c2c1 |
| InChI | InChI=1S/C17H19NO6/c1-9(19)23-14-12-7-6-11(18-3)8-13(12)15(24-10(2)20)17(22-5)16(14)21-4/h6-8,18H,1-5H3 |
| InChIKey | ANXZVDJDIJGOAR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|