C15H18O8 — CID 11759186
(2-acetyl-5-acetyloxy-3,4,6-trimethoxyphenyl) acetate (PubChem CID 11759186) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is (2-acetyl-5-acetyloxy-3,4,6-trimethoxyphenyl) acetate.
| Compound Name | (2-acetyl-5-acetyloxy-3,4,6-trimethoxyphenyl) acetate |
|---|---|
| PubChem CID | 11759186 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (2-acetyl-5-acetyloxy-3,4,6-trimethoxyphenyl) acetate |
| SMILES | COc1c(OC(C)=O)c(OC)c(OC(C)=O)c(C(C)=O)c1OC |
| InChI | InChI=1S/C15H18O8/c1-7(16)10-11(19-4)13(20-5)15(23-9(3)18)14(21-6)12(10)22-8(2)17/h1-6H3 |
| InChIKey | AQETUSCVERNSMC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|