C11H14O6 — CID 176684182
(2,5-dihydroxy-3,6-dimethoxy-4-methylphenyl) acetate (PubChem CID 176684182) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is (2,5-dihydroxy-3,6-dimethoxy-4-methylphenyl) acetate.
| Compound Name | (2,5-dihydroxy-3,6-dimethoxy-4-methylphenyl) acetate |
|---|---|
| PubChem CID | 176684182 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (2,5-dihydroxy-3,6-dimethoxy-4-methylphenyl) acetate |
| SMILES | COc1c(C)c(O)c(OC)c(OC(C)=O)c1O |
| InChI | InChI=1S/C11H14O6/c1-5-7(13)10(16-4)11(17-6(2)12)8(14)9(5)15-3/h13-14H,1-4H3 |
| InChIKey | XZQVTHQJYNWXEU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|