C15H13NO5 — CID 23038504
(7-cyano-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) acetate (PubChem CID 23038504) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is (7-cyano-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) acetate.
| Compound Name | (7-cyano-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 23038504 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (7-cyano-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) acetate |
| SMILES | COc1c(OC)c(OC(C)=O)c2cc(C#N)ccc2c1O |
| InChI | InChI=1S/C15H13NO5/c1-8(17)21-13-11-6-9(7-16)4-5-10(11)12(18)14(19-2)15(13)20-3/h4-6,18H,1-3H3 |
| InChIKey | RLYKPACLUSYPPL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|