C17H11NO4 — CID 175081302
(7-cyano-10-hydroxy-1-methylphenanthren-9-yl) hydrogen carbonate (PubChem CID 175081302) has the molecular formula C17H11NO4 and a molecular weight of 293.28 g/mol. Its IUPAC name is (7-cyano-10-hydroxy-1-methylphenanthren-9-yl) hydrogen carbonate.
| Compound Name | (7-cyano-10-hydroxy-1-methylphenanthren-9-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 175081302 |
| Molecular Formula | C17H11NO4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (7-cyano-10-hydroxy-1-methylphenanthren-9-yl) hydrogen carbonate |
| SMILES | Cc1cccc2c1c(O)c(OC(=O)O)c1cc(C#N)ccc12 |
| InChI | InChI=1S/C17H11NO4/c1-9-3-2-4-12-11-6-5-10(8-18)7-13(11)16(22-17(20)21)15(19)14(9)12/h2-7,19H,1H3,(H,20,21) |
| InChIKey | FXXQIUOLXQMZJP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|