About (2,4-dicyanophenyl) acetate
(2,4-dicyanophenyl) acetate (PubChem CID 86110508) has the molecular formula C10H6N2O2
and a molecular weight of 186.17 g/mol. Its IUPAC name is (2,4-dicyanophenyl) acetate.
Molecular Properties
| Compound Name | (2,4-dicyanophenyl) acetate |
| PubChem CID | 86110508 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (2,4-dicyanophenyl) acetate |
| SMILES | CC(=O)Oc1ccc(C#N)cc1C#N |
| InChI | InChI=1S/C10H6N2O2/c1-7(13)14-10-3-2-8(5-11)4-9(10)6-12/h2-4H,1H3 |
| InChIKey | RGKXGTFNDGFDIV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dicyanophenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dicyanophenyl) acetate?
The IUPAC name of (2,4-dicyanophenyl) acetate (CID 86110508) is (2,4-dicyanophenyl) acetate.
What is the SMILES notation for (2,4-dicyanophenyl) acetate?
The canonical SMILES for (2,4-dicyanophenyl) acetate is CC(=O)Oc1ccc(C#N)cc1C#N.
What is the InChIKey of (2,4-dicyanophenyl) acetate?
The InChIKey is RGKXGTFNDGFDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2/c1-7(13)14-10-3-2-8(5-11)4-9(10)6-12/h2-4H,1H3.
What are the key properties of (2,4-dicyanophenyl) acetate?
(2,4-dicyanophenyl) acetate has a molecular weight of 186.17 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dicyanophenyl) acetate is sourced from PubChem (CID 86110508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).