About (4-amino-2-cyanophenyl) ethaneperoxoate
(4-amino-2-cyanophenyl) ethaneperoxoate (PubChem CID 87651236) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is (4-amino-2-cyanophenyl) ethaneperoxoate.
Molecular Properties
| Compound Name | (4-amino-2-cyanophenyl) ethaneperoxoate |
| PubChem CID | 87651236 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (4-amino-2-cyanophenyl) ethaneperoxoate |
| SMILES | CC(=O)OOc1ccc(N)cc1C#N |
| InChI | InChI=1S/C9H8N2O3/c1-6(12)13-14-9-3-2-8(11)4-7(9)5-10/h2-4H,11H2,1H3 |
| InChIKey | UHFUVIADHRVZRM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2-cyanophenyl) ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-cyanophenyl) ethaneperoxoate?
The IUPAC name of (4-amino-2-cyanophenyl) ethaneperoxoate (CID 87651236) is (4-amino-2-cyanophenyl) ethaneperoxoate.
What is the SMILES notation for (4-amino-2-cyanophenyl) ethaneperoxoate?
The canonical SMILES for (4-amino-2-cyanophenyl) ethaneperoxoate is CC(=O)OOc1ccc(N)cc1C#N.
What is the InChIKey of (4-amino-2-cyanophenyl) ethaneperoxoate?
The InChIKey is UHFUVIADHRVZRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c1-6(12)13-14-9-3-2-8(11)4-7(9)5-10/h2-4H,11H2,1H3.
What are the key properties of (4-amino-2-cyanophenyl) ethaneperoxoate?
(4-amino-2-cyanophenyl) ethaneperoxoate has a molecular weight of 192.17 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-cyanophenyl) ethaneperoxoate is sourced from PubChem (CID 87651236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).