C14H11N3O3 — CID 69333705
[4-(4-amino-2-cyanophenoxy)phenyl]carbamic acid (PubChem CID 69333705) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is [4-(4-amino-2-cyanophenoxy)phenyl]carbamic acid.
| Compound Name | [4-(4-amino-2-cyanophenoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 69333705 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [4-(4-amino-2-cyanophenoxy)phenyl]carbamic acid |
| SMILES | N#Cc1cc(N)ccc1Oc1ccc(NC(=O)O)cc1 |
| InChI | InChI=1S/C14H11N3O3/c15-8-9-7-10(16)1-6-13(9)20-12-4-2-11(3-5-12)17-14(18)19/h1-7,17H,16H2,(H,18,19) |
| InChIKey | FRCPUUDQRAMHHQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|