About (3-cyano-2-methylphenyl) ethaneperoxoate
(3-cyano-2-methylphenyl) ethaneperoxoate (PubChem CID 87802063) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is (3-cyano-2-methylphenyl) ethaneperoxoate.
Molecular Properties
| Compound Name | (3-cyano-2-methylphenyl) ethaneperoxoate |
| PubChem CID | 87802063 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (3-cyano-2-methylphenyl) ethaneperoxoate |
| SMILES | CC(=O)OOc1cccc(C#N)c1C |
| InChI | InChI=1S/C10H9NO3/c1-7-9(6-11)4-3-5-10(7)14-13-8(2)12/h3-5H,1-2H3 |
| InChIKey | PWTVKAPHIUAXGS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-2-methylphenyl) ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-2-methylphenyl) ethaneperoxoate?
The IUPAC name of (3-cyano-2-methylphenyl) ethaneperoxoate (CID 87802063) is (3-cyano-2-methylphenyl) ethaneperoxoate.
What is the SMILES notation for (3-cyano-2-methylphenyl) ethaneperoxoate?
The canonical SMILES for (3-cyano-2-methylphenyl) ethaneperoxoate is CC(=O)OOc1cccc(C#N)c1C.
What is the InChIKey of (3-cyano-2-methylphenyl) ethaneperoxoate?
The InChIKey is PWTVKAPHIUAXGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-7-9(6-11)4-3-5-10(7)14-13-8(2)12/h3-5H,1-2H3.
What are the key properties of (3-cyano-2-methylphenyl) ethaneperoxoate?
(3-cyano-2-methylphenyl) ethaneperoxoate has a molecular weight of 191.19 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-2-methylphenyl) ethaneperoxoate is sourced from PubChem (CID 87802063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).