About tritio 2-cyano-6-methylbenzoate
tritio 2-cyano-6-methylbenzoate (PubChem CID 88949376) has the molecular formula C9H7NO2
and a molecular weight of 163.17 g/mol. Its IUPAC name is tritio 2-cyano-6-methylbenzoate.
Molecular Properties
| Compound Name | tritio 2-cyano-6-methylbenzoate |
| PubChem CID | 88949376 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | tritio 2-cyano-6-methylbenzoate |
| SMILES | [3H]OC(=O)c1c(C)cccc1C#N |
| InChI | InChI=1S/C9H7NO2/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4H,1H3,(H,11,12)/i/hT |
| InChIKey | UOXNPUVCYMBNFL-MNYXATJNSA-N |
| XLogP | 1.56 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tritio 2-cyano-6-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tritio 2-cyano-6-methylbenzoate?
The IUPAC name of tritio 2-cyano-6-methylbenzoate (CID 88949376) is tritio 2-cyano-6-methylbenzoate.
What is the SMILES notation for tritio 2-cyano-6-methylbenzoate?
The canonical SMILES for tritio 2-cyano-6-methylbenzoate is [3H]OC(=O)c1c(C)cccc1C#N.
What is the InChIKey of tritio 2-cyano-6-methylbenzoate?
The InChIKey is UOXNPUVCYMBNFL-MNYXATJNSA-N. The full InChI is InChI=1S/C9H7NO2/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4H,1H3,(H,11,12)/i/hT.
What are the key properties of tritio 2-cyano-6-methylbenzoate?
tritio 2-cyano-6-methylbenzoate has a molecular weight of 163.17 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tritio 2-cyano-6-methylbenzoate is sourced from PubChem (CID 88949376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).