tritio 2-cyano-6-methylbenzoate

C9H7NO2 — CID 88949376

IUPACtritio 2-cyano-6-methylbenzoate
SMILES[3H]OC(=O)c1c(C)cccc1C#N
InChIInChI=1S/C9H7NO2/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4H,1H3,(H,11,12)/i/hT
InChIKeyUOXNPUVCYMBNFL-MNYXATJNSA-N
MW163.17 g/mol
LogP1.56
Rot. Bonds1

About tritio 2-cyano-6-methylbenzoate

tritio 2-cyano-6-methylbenzoate (PubChem CID 88949376) has the molecular formula C9H7NO2 and a molecular weight of 163.17 g/mol. Its IUPAC name is tritio 2-cyano-6-methylbenzoate.

Molecular Properties

Compound Nametritio 2-cyano-6-methylbenzoate
PubChem CID88949376
Molecular FormulaC9H7NO2
Molecular Weight163.17 g/mol
Exact Mass163.06
IUPAC Nametritio 2-cyano-6-methylbenzoate
SMILES[3H]OC(=O)c1c(C)cccc1C#N
InChIInChI=1S/C9H7NO2/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4H,1H3,(H,11,12)/i/hT
InChIKeyUOXNPUVCYMBNFL-MNYXATJNSA-N
XLogP1.56
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.17
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze tritio 2-cyano-6-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tritio 2-cyano-6-methylbenzoate?
The IUPAC name of tritio 2-cyano-6-methylbenzoate (CID 88949376) is tritio 2-cyano-6-methylbenzoate.
What is the SMILES notation for tritio 2-cyano-6-methylbenzoate?
The canonical SMILES for tritio 2-cyano-6-methylbenzoate is [3H]OC(=O)c1c(C)cccc1C#N.
What is the InChIKey of tritio 2-cyano-6-methylbenzoate?
The InChIKey is UOXNPUVCYMBNFL-MNYXATJNSA-N. The full InChI is InChI=1S/C9H7NO2/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4H,1H3,(H,11,12)/i/hT.
What are the key properties of tritio 2-cyano-6-methylbenzoate?
tritio 2-cyano-6-methylbenzoate has a molecular weight of 163.17 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tritio 2-cyano-6-methylbenzoate is sourced from PubChem (CID 88949376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).