About ethyl 2-amino-6-cyanobenzoate
ethyl 2-amino-6-cyanobenzoate (PubChem CID 91873808) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is ethyl 2-amino-6-cyanobenzoate.
Molecular Properties
| Compound Name | ethyl 2-amino-6-cyanobenzoate |
| PubChem CID | 91873808 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | ethyl 2-amino-6-cyanobenzoate |
| SMILES | CCOC(=O)c1c(N)cccc1C#N |
| InChI | InChI=1S/C10H10N2O2/c1-2-14-10(13)9-7(6-11)4-3-5-8(9)12/h3-5H,2,12H2,1H3 |
| InChIKey | CDNCAMOSCWWICM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-6-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-6-cyanobenzoate?
The IUPAC name of ethyl 2-amino-6-cyanobenzoate (CID 91873808) is ethyl 2-amino-6-cyanobenzoate.
What is the SMILES notation for ethyl 2-amino-6-cyanobenzoate?
The canonical SMILES for ethyl 2-amino-6-cyanobenzoate is CCOC(=O)c1c(N)cccc1C#N.
What is the InChIKey of ethyl 2-amino-6-cyanobenzoate?
The InChIKey is CDNCAMOSCWWICM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-2-14-10(13)9-7(6-11)4-3-5-8(9)12/h3-5H,2,12H2,1H3.
What are the key properties of ethyl 2-amino-6-cyanobenzoate?
ethyl 2-amino-6-cyanobenzoate has a molecular weight of 190.20 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-6-cyanobenzoate is sourced from PubChem (CID 91873808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).