About (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate
(2-cyanophenyl)methyl 2-amino-6-methoxybenzoate (PubChem CID 81396523) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate.
Molecular Properties
| Compound Name | (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate |
| PubChem CID | 81396523 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate |
| SMILES | COc1cccc(N)c1C(=O)OCc1ccccc1C#N |
| InChI | InChI=1S/C16H14N2O3/c1-20-14-8-4-7-13(18)15(14)16(19)21-10-12-6-3-2-5-11(12)9-17/h2-8H,10,18H2,1H3 |
| InChIKey | UBODKRLYNKHHEM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate?
The IUPAC name of (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate (CID 81396523) is (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate.
What is the SMILES notation for (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate?
The canonical SMILES for (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate is COc1cccc(N)c1C(=O)OCc1ccccc1C#N.
What is the InChIKey of (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate?
The InChIKey is UBODKRLYNKHHEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-20-14-8-4-7-13(18)15(14)16(19)21-10-12-6-3-2-5-11(12)9-17/h2-8H,10,18H2,1H3.
What are the key properties of (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate?
(2-cyanophenyl)methyl 2-amino-6-methoxybenzoate has a molecular weight of 282.30 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)methyl 2-amino-6-methoxybenzoate is sourced from PubChem (CID 81396523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).