About (2-cyanophenyl)methyl 2-methoxybenzoate
(2-cyanophenyl)methyl 2-methoxybenzoate (PubChem CID 2640366) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | (2-cyanophenyl)methyl 2-methoxybenzoate |
| PubChem CID | 2640366 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (2-cyanophenyl)methyl 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCc1ccccc1C#N |
| InChI | InChI=1S/C16H13NO3/c1-19-15-9-5-4-8-14(15)16(18)20-11-13-7-3-2-6-12(13)10-17/h2-9H,11H2,1H3 |
| InChIKey | GEMUVMFJSNHISY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyanophenyl)methyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl)methyl 2-methoxybenzoate?
The IUPAC name of (2-cyanophenyl)methyl 2-methoxybenzoate (CID 2640366) is (2-cyanophenyl)methyl 2-methoxybenzoate.
What is the SMILES notation for (2-cyanophenyl)methyl 2-methoxybenzoate?
The canonical SMILES for (2-cyanophenyl)methyl 2-methoxybenzoate is COc1ccccc1C(=O)OCc1ccccc1C#N.
What is the InChIKey of (2-cyanophenyl)methyl 2-methoxybenzoate?
The InChIKey is GEMUVMFJSNHISY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3/c1-19-15-9-5-4-8-14(15)16(18)20-11-13-7-3-2-6-12(13)10-17/h2-9H,11H2,1H3.
What are the key properties of (2-cyanophenyl)methyl 2-methoxybenzoate?
(2-cyanophenyl)methyl 2-methoxybenzoate has a molecular weight of 267.28 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)methyl 2-methoxybenzoate is sourced from PubChem (CID 2640366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).