C12H13N3O4 — CID 81414455
[2-(cyanomethylamino)-2-oxoethyl] 2-amino-6-methoxybenzoate (PubChem CID 81414455) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is [2-(cyanomethylamino)-2-oxoethyl] 2-amino-6-methoxybenzoate.
| Compound Name | [2-(cyanomethylamino)-2-oxoethyl] 2-amino-6-methoxybenzoate |
|---|---|
| PubChem CID | 81414455 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | [2-(cyanomethylamino)-2-oxoethyl] 2-amino-6-methoxybenzoate |
| SMILES | COc1cccc(N)c1C(=O)OCC(=O)NCC#N |
| InChI | InChI=1S/C12H13N3O4/c1-18-9-4-2-3-8(14)11(9)12(17)19-7-10(16)15-6-5-13/h2-4H,6-7,14H2,1H3,(H,15,16) |
| InChIKey | WIXQNOGFQHNUGK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|