C9H9N3O3S — CID 61316603
[2-(cyanomethylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate (PubChem CID 61316603) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is [2-(cyanomethylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate.
| Compound Name | [2-(cyanomethylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 61316603 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | [2-(cyanomethylamino)-2-oxoethyl] 3-aminothiophene-2-carboxylate |
| SMILES | N#CCNC(=O)COC(=O)c1sccc1N |
| InChI | InChI=1S/C9H9N3O3S/c10-2-3-12-7(13)5-15-9(14)8-6(11)1-4-16-8/h1,4H,3,5,11H2,(H,12,13) |
| InChIKey | KVSZYEOGYAXJHH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|