C15H15NO3S — CID 3266695
[2-(benzylamino)-2-oxoethyl] 3-methylthiophene-2-carboxylate (PubChem CID 3266695) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 3266695 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)OCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H15NO3S/c1-11-7-8-20-14(11)15(18)19-10-13(17)16-9-12-5-3-2-4-6-12/h2-8H,9-10H2,1H3,(H,16,17) |
| InChIKey | OVTHDLABAJKAAQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |