C23H23NO3S — CID 7835067
[2-(3,3-diphenylpropylamino)-2-oxoethyl] 3-methylthiophene-2-carboxylate (PubChem CID 7835067) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is [2-(3,3-diphenylpropylamino)-2-oxoethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [2-(3,3-diphenylpropylamino)-2-oxoethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7835067 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-(3,3-diphenylpropylamino)-2-oxoethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)OCC(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S/c1-17-13-15-28-22(17)23(26)27-16-21(25)24-14-12-20(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,13,15,20H,12,14,16H2,1H3,(H,24,25) |
| InChIKey | DYSKLPUWNANXKZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |