C22H22N2O3 — CID 8546573
[2-(3,3-diphenylpropylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8546573) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is [2-(3,3-diphenylpropylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-(3,3-diphenylpropylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8546573 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [2-(3,3-diphenylpropylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc[nH]1)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O3/c25-21(16-27-22(26)20-12-7-14-23-20)24-15-13-19(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-12,14,19,23H,13,15-16H2,(H,24,25) |
| InChIKey | KSCGXRWQENHDRG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |