C25H25NO4 — CID 7501846
[2-(3,3-diphenylpropylamino)-2-oxoethyl] 4-(hydroxymethyl)benzoate (PubChem CID 7501846) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-(3,3-diphenylpropylamino)-2-oxoethyl] 4-(hydroxymethyl)benzoate.
| Compound Name | [2-(3,3-diphenylpropylamino)-2-oxoethyl] 4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 7501846 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [2-(3,3-diphenylpropylamino)-2-oxoethyl] 4-(hydroxymethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(CO)cc1)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO4/c27-17-19-11-13-22(14-12-19)25(29)30-18-24(28)26-16-15-23(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,23,27H,15-18H2,(H,26,28) |
| InChIKey | MNGSDLOFUKOXNF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |