C18H18ClNO5 — CID 8845463
[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 4-(hydroxymethyl)benzoate (PubChem CID 8845463) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 4-(hydroxymethyl)benzoate.
| Compound Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 8845463 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 4-(hydroxymethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(CO)cc1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO5/c19-15-5-7-16(8-6-15)24-10-9-20-17(22)12-25-18(23)14-3-1-13(11-21)2-4-14/h1-8,21H,9-12H2,(H,20,22) |
| InChIKey | FIDJGQVPALVPDP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|