C21H21ClN2O5 — CID 8581429
[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 8581429) has the molecular formula C21H21ClN2O5 and a molecular weight of 416.86 g/mol. Its IUPAC name is [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8581429 |
| Molecular Formula | C21H21ClN2O5 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCCC2=O)cc1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O5/c22-16-5-9-18(10-6-16)28-13-11-23-19(25)14-29-21(27)15-3-7-17(8-4-15)24-12-1-2-20(24)26/h3-10H,1-2,11-14H2,(H,23,25) |
| InChIKey | ZNUAXFFUFQDCCP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|