C14H15NO3S — CID 65446877
2-(4-methoxyphenyl)ethyl 3-aminothiophene-2-carboxylate (PubChem CID 65446877) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl 3-aminothiophene-2-carboxylate.
| Compound Name | 2-(4-methoxyphenyl)ethyl 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 65446877 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl 3-aminothiophene-2-carboxylate |
| SMILES | COc1ccc(CCOC(=O)c2sccc2N)cc1 |
| InChI | InChI=1S/C14H15NO3S/c1-17-11-4-2-10(3-5-11)6-8-18-14(16)13-12(15)7-9-19-13/h2-5,7,9H,6,8,15H2,1H3 |
| InChIKey | JSLDWRBKLOEJLK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |