C11H17NO4S2 — CID 106728783
2-tert-butylsulfonylethyl 3-aminothiophene-2-carboxylate (PubChem CID 106728783) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-tert-butylsulfonylethyl 3-aminothiophene-2-carboxylate.
| Compound Name | 2-tert-butylsulfonylethyl 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 106728783 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-tert-butylsulfonylethyl 3-aminothiophene-2-carboxylate |
| SMILES | CC(C)(C)S(=O)(=O)CCOC(=O)c1sccc1N |
| InChI | InChI=1S/C11H17NO4S2/c1-11(2,3)18(14,15)7-5-16-10(13)9-8(12)4-6-17-9/h4,6H,5,7,12H2,1-3H3 |
| InChIKey | IOTQWAZCDXETQI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |