About 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate
2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate (PubChem CID 106728776) has the molecular formula C13H18FNO4S
and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate.
Molecular Properties
| Compound Name | 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate |
| PubChem CID | 106728776 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate |
| SMILES | CC(C)(C)S(=O)(=O)CCOC(=O)c1cc(F)ccc1N |
| InChI | InChI=1S/C13H18FNO4S/c1-13(2,3)20(17,18)7-6-19-12(16)10-8-9(14)4-5-11(10)15/h4-5,8H,6-7,15H2,1-3H3 |
| InChIKey | XCMFRUSQIUVCEK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate?
The IUPAC name of 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate (CID 106728776) is 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate.
What is the SMILES notation for 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate?
The canonical SMILES for 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate is CC(C)(C)S(=O)(=O)CCOC(=O)c1cc(F)ccc1N.
What is the InChIKey of 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate?
The InChIKey is XCMFRUSQIUVCEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO4S/c1-13(2,3)20(17,18)7-6-19-12(16)10-8-9(14)4-5-11(10)15/h4-5,8H,6-7,15H2,1-3H3.
What are the key properties of 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate?
2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate has a molecular weight of 303.35 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylsulfonylethyl 2-amino-5-fluorobenzoate is sourced from PubChem (CID 106728776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).