C10H15NO4S2 — CID 106728784
2-propylsulfonylethyl 3-aminothiophene-2-carboxylate (PubChem CID 106728784) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-propylsulfonylethyl 3-aminothiophene-2-carboxylate.
| Compound Name | 2-propylsulfonylethyl 3-aminothiophene-2-carboxylate |
|---|---|
| PubChem CID | 106728784 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-propylsulfonylethyl 3-aminothiophene-2-carboxylate |
| SMILES | CCCS(=O)(=O)CCOC(=O)c1sccc1N |
| InChI | InChI=1S/C10H15NO4S2/c1-2-6-17(13,14)7-4-15-10(12)9-8(11)3-5-16-9/h3,5H,2,4,6-7,11H2,1H3 |
| InChIKey | WIVDNJHQBQBIQB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |