About 2-propylsulfonylethyl 4-amino-3-fluorobenzoate
2-propylsulfonylethyl 4-amino-3-fluorobenzoate (PubChem CID 106728823) has the molecular formula C12H16FNO4S
and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-propylsulfonylethyl 4-amino-3-fluorobenzoate.
Molecular Properties
| Compound Name | 2-propylsulfonylethyl 4-amino-3-fluorobenzoate |
| PubChem CID | 106728823 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-propylsulfonylethyl 4-amino-3-fluorobenzoate |
| SMILES | CCCS(=O)(=O)CCOC(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C12H16FNO4S/c1-2-6-19(16,17)7-5-18-12(15)9-3-4-11(14)10(13)8-9/h3-4,8H,2,5-7,14H2,1H3 |
| InChIKey | VNCSAZQAKJWAHO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propylsulfonylethyl 4-amino-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfonylethyl 4-amino-3-fluorobenzoate?
The IUPAC name of 2-propylsulfonylethyl 4-amino-3-fluorobenzoate (CID 106728823) is 2-propylsulfonylethyl 4-amino-3-fluorobenzoate.
What is the SMILES notation for 2-propylsulfonylethyl 4-amino-3-fluorobenzoate?
The canonical SMILES for 2-propylsulfonylethyl 4-amino-3-fluorobenzoate is CCCS(=O)(=O)CCOC(=O)c1ccc(N)c(F)c1.
What is the InChIKey of 2-propylsulfonylethyl 4-amino-3-fluorobenzoate?
The InChIKey is VNCSAZQAKJWAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO4S/c1-2-6-19(16,17)7-5-18-12(15)9-3-4-11(14)10(13)8-9/h3-4,8H,2,5-7,14H2,1H3.
What are the key properties of 2-propylsulfonylethyl 4-amino-3-fluorobenzoate?
2-propylsulfonylethyl 4-amino-3-fluorobenzoate has a molecular weight of 289.33 g/mol, XLogP of 1.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfonylethyl 4-amino-3-fluorobenzoate is sourced from PubChem (CID 106728823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).