About 2-propylsulfonylethyl 3-amino-5-methoxybenzoate
2-propylsulfonylethyl 3-amino-5-methoxybenzoate (PubChem CID 106728853) has the molecular formula C13H19NO5S
and a molecular weight of 301.36 g/mol. Its IUPAC name is 2-propylsulfonylethyl 3-amino-5-methoxybenzoate.
Molecular Properties
| Compound Name | 2-propylsulfonylethyl 3-amino-5-methoxybenzoate |
| PubChem CID | 106728853 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-propylsulfonylethyl 3-amino-5-methoxybenzoate |
| SMILES | CCCS(=O)(=O)CCOC(=O)c1cc(N)cc(OC)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-3-5-20(16,17)6-4-19-13(15)10-7-11(14)9-12(8-10)18-2/h7-9H,3-6,14H2,1-2H3 |
| InChIKey | HUYQHUHTVLTUHZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propylsulfonylethyl 3-amino-5-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfonylethyl 3-amino-5-methoxybenzoate?
The IUPAC name of 2-propylsulfonylethyl 3-amino-5-methoxybenzoate (CID 106728853) is 2-propylsulfonylethyl 3-amino-5-methoxybenzoate.
What is the SMILES notation for 2-propylsulfonylethyl 3-amino-5-methoxybenzoate?
The canonical SMILES for 2-propylsulfonylethyl 3-amino-5-methoxybenzoate is CCCS(=O)(=O)CCOC(=O)c1cc(N)cc(OC)c1.
What is the InChIKey of 2-propylsulfonylethyl 3-amino-5-methoxybenzoate?
The InChIKey is HUYQHUHTVLTUHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5S/c1-3-5-20(16,17)6-4-19-13(15)10-7-11(14)9-12(8-10)18-2/h7-9H,3-6,14H2,1-2H3.
What are the key properties of 2-propylsulfonylethyl 3-amino-5-methoxybenzoate?
2-propylsulfonylethyl 3-amino-5-methoxybenzoate has a molecular weight of 301.36 g/mol, XLogP of 1.26, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfonylethyl 3-amino-5-methoxybenzoate is sourced from PubChem (CID 106728853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).