C13H12ClN — CID 163977319
3-[(2E)-4-chloropenta-2,4-dien-2-yl]-2-methylbenzonitrile (PubChem CID 163977319) has the molecular formula C13H12ClN and a molecular weight of 217.70 g/mol. Its IUPAC name is 3-[(2E)-4-chloropenta-2,4-dien-2-yl]-2-methylbenzonitrile.
| Compound Name | 3-[(2E)-4-chloropenta-2,4-dien-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 163977319 |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-[(2E)-4-chloropenta-2,4-dien-2-yl]-2-methylbenzonitrile |
| SMILES | C=C(Cl)/C=C(\C)c1cccc(C#N)c1C |
| InChI | InChI=1S/C13H12ClN/c1-9(7-10(2)14)13-6-4-5-12(8-15)11(13)3/h4-7H,2H2,1,3H3/b9-7+ |
| InChIKey | SVHPHQOHXZXDQD-VQHVLOKHSA-N |
| XLogP | 4.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|