C17H19N — CID 166682790
3-[(1E,3Z)-2-ethenyl-3-methylhexa-1,3-dienyl]-2-methylbenzonitrile (PubChem CID 166682790) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[(1E,3Z)-2-ethenyl-3-methylhexa-1,3-dienyl]-2-methylbenzonitrile.
| Compound Name | 3-[(1E,3Z)-2-ethenyl-3-methylhexa-1,3-dienyl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 166682790 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-[(1E,3Z)-2-ethenyl-3-methylhexa-1,3-dienyl]-2-methylbenzonitrile |
| SMILES | C=CC(=C\c1cccc(C#N)c1C)/C(C)=C\CC |
| InChI | InChI=1S/C17H19N/c1-5-8-13(3)15(6-2)11-16-9-7-10-17(12-18)14(16)4/h6-11H,2,5H2,1,3-4H3/b13-8-,15-11+ |
| InChIKey | PVDCDKKRQCLIDW-QMGJEZHQSA-N |
| XLogP | 4.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|