About (2,3-dichlorophenyl) ethaneperoxoate
(2,3-dichlorophenyl) ethaneperoxoate (PubChem CID 87265241) has the molecular formula C8H6Cl2O3
and a molecular weight of 221.04 g/mol. Its IUPAC name is (2,3-dichlorophenyl) ethaneperoxoate.
Molecular Properties
| Compound Name | (2,3-dichlorophenyl) ethaneperoxoate |
| PubChem CID | 87265241 |
| Molecular Formula | C8H6Cl2O3 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | (2,3-dichlorophenyl) ethaneperoxoate |
| SMILES | CC(=O)OOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2O3/c1-5(11)12-13-7-4-2-3-6(9)8(7)10/h2-4H,1H3 |
| InChIKey | GLCIENYSYGDNIL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dichlorophenyl) ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dichlorophenyl) ethaneperoxoate?
The IUPAC name of (2,3-dichlorophenyl) ethaneperoxoate (CID 87265241) is (2,3-dichlorophenyl) ethaneperoxoate.
What is the SMILES notation for (2,3-dichlorophenyl) ethaneperoxoate?
The canonical SMILES for (2,3-dichlorophenyl) ethaneperoxoate is CC(=O)OOc1cccc(Cl)c1Cl.
What is the InChIKey of (2,3-dichlorophenyl) ethaneperoxoate?
The InChIKey is GLCIENYSYGDNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O3/c1-5(11)12-13-7-4-2-3-6(9)8(7)10/h2-4H,1H3.
What are the key properties of (2,3-dichlorophenyl) ethaneperoxoate?
(2,3-dichlorophenyl) ethaneperoxoate has a molecular weight of 221.04 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichlorophenyl) ethaneperoxoate is sourced from PubChem (CID 87265241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).