C9H9Cl2NO2 — CID 7372370
(2R)-2-(2,3-dichlorophenoxy)propanamide (PubChem CID 7372370) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is (2R)-2-(2,3-dichlorophenoxy)propanamide.
| Compound Name | (2R)-2-(2,3-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 7372370 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | (2R)-2-(2,3-dichlorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1cccc(Cl)c1Cl)C(N)=O |
| InChI | InChI=1S/C9H9Cl2NO2/c1-5(9(12)13)14-7-4-2-3-6(10)8(7)11/h2-5H,1H3,(H2,12,13)/t5-/m1/s1 |
| InChIKey | JOQYWSFHJCWHJM-RXMQYKEDSA-N |
| XLogP | 2.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |