C8H7BrCl2O — CID 67903309
1-(1-bromoethoxy)-2,3-dichlorobenzene (PubChem CID 67903309) has the molecular formula C8H7BrCl2O and a molecular weight of 269.95 g/mol. Its IUPAC name is 1-(1-bromoethoxy)-2,3-dichlorobenzene.
| Compound Name | 1-(1-bromoethoxy)-2,3-dichlorobenzene |
|---|---|
| PubChem CID | 67903309 |
| Molecular Formula | C8H7BrCl2O |
| Molecular Weight | 269.95 g/mol |
| Exact Mass | 267.91 |
| IUPAC Name | 1-(1-bromoethoxy)-2,3-dichlorobenzene |
| SMILES | CC(Br)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H7BrCl2O/c1-5(9)12-7-4-2-3-6(10)8(7)11/h2-5H,1H3 |
| InChIKey | BFMBKBNZPBJECW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.95 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|