C10H12Cl2O3 — CID 173367803
1,2-dichloro-3-[ethoxy(methoxy)methoxy]benzene (PubChem CID 173367803) has the molecular formula C10H12Cl2O3 and a molecular weight of 251.11 g/mol. Its IUPAC name is 1,2-dichloro-3-[ethoxy(methoxy)methoxy]benzene.
| Compound Name | 1,2-dichloro-3-[ethoxy(methoxy)methoxy]benzene |
|---|---|
| PubChem CID | 173367803 |
| Molecular Formula | C10H12Cl2O3 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1,2-dichloro-3-[ethoxy(methoxy)methoxy]benzene |
| SMILES | CCOC(OC)Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl2O3/c1-3-14-10(13-2)15-8-6-4-5-7(11)9(8)12/h4-6,10H,3H2,1-2H3 |
| InChIKey | AQNIDOYBGKCAOJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|