C11H16Cl2N2O2 — CID 57053992
1-(1-aminoethylamino)-1-(2,3-dichlorophenoxy)propan-2-ol (PubChem CID 57053992) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is 1-(1-aminoethylamino)-1-(2,3-dichlorophenoxy)propan-2-ol.
| Compound Name | 1-(1-aminoethylamino)-1-(2,3-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 57053992 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-(1-aminoethylamino)-1-(2,3-dichlorophenoxy)propan-2-ol |
| SMILES | CC(N)NC(Oc1cccc(Cl)c1Cl)C(C)O |
| InChI | InChI=1S/C11H16Cl2N2O2/c1-6(16)11(15-7(2)14)17-9-5-3-4-8(12)10(9)13/h3-7,11,15-16H,14H2,1-2H3 |
| InChIKey | CHXKRQUDERUQNK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|