C17H20Cl2N2O2 — CID 175391069
1-[[2-amino-2-(2,6-dichlorophenyl)ethyl]amino]-1-phenoxypropan-2-ol (PubChem CID 175391069) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.26 g/mol. Its IUPAC name is 1-[[2-amino-2-(2,6-dichlorophenyl)ethyl]amino]-1-phenoxypropan-2-ol.
| Compound Name | 1-[[2-amino-2-(2,6-dichlorophenyl)ethyl]amino]-1-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 175391069 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[[2-amino-2-(2,6-dichlorophenyl)ethyl]amino]-1-phenoxypropan-2-ol |
| SMILES | CC(O)C(NCC(N)c1c(Cl)cccc1Cl)Oc1ccccc1 |
| InChI | InChI=1S/C17H20Cl2N2O2/c1-11(22)17(23-12-6-3-2-4-7-12)21-10-15(20)16-13(18)8-5-9-14(16)19/h2-9,11,15,17,21-22H,10,20H2,1H3 |
| InChIKey | KUXCMIPXINKFTA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|