C9H5F2NO2 — CID 151898327
(4-cyano-2,6-difluorophenyl) acetate (PubChem CID 151898327) has the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. Its IUPAC name is (4-cyano-2,6-difluorophenyl) acetate.
| Compound Name | (4-cyano-2,6-difluorophenyl) acetate |
|---|---|
| PubChem CID | 151898327 |
| Molecular Formula | C9H5F2NO2 |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | (4-cyano-2,6-difluorophenyl) acetate |
| SMILES | CC(=O)Oc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C9H5F2NO2/c1-5(13)14-9-7(10)2-6(4-12)3-8(9)11/h2-3H,1H3 |
| InChIKey | SSFJOGMVHXBQMT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|