C24H21Cl2NO5 — CID 23038701
[7-cyano-4-[1-(2,4-dichlorophenyl)propoxy]-2,3-dimethoxynaphthalen-1-yl] acetate (PubChem CID 23038701) has the molecular formula C24H21Cl2NO5 and a molecular weight of 474.34 g/mol. Its IUPAC name is [7-cyano-4-[1-(2,4-dichlorophenyl)propoxy]-2,3-dimethoxynaphthalen-1-yl] acetate.
| Compound Name | [7-cyano-4-[1-(2,4-dichlorophenyl)propoxy]-2,3-dimethoxynaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 23038701 |
| Molecular Formula | C24H21Cl2NO5 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [7-cyano-4-[1-(2,4-dichlorophenyl)propoxy]-2,3-dimethoxynaphthalen-1-yl] acetate |
| SMILES | CCC(Oc1c(OC)c(OC)c(OC(C)=O)c2cc(C#N)ccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H21Cl2NO5/c1-5-20(17-9-7-15(25)11-19(17)26)32-21-16-8-6-14(12-27)10-18(16)22(31-13(2)28)24(30-4)23(21)29-3/h6-11,20H,5H2,1-4H3 |
| InChIKey | YGBGTOHRJOAJDT-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|